Products 1404878-98-3
CAS 1404878-98-3 is the registry number for 2,3-Dichloro-N-Boc-DL-phenylalanine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2,3-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1404878-98-3) is a chemical compound with the molecular formula C14H17Cl2NO4 and a molecular weight of 334.2 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: NMXTYWWEDGNCRZ-UHFFFAOYSA-N.
| Molecular formula | C14H17Cl2NO4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | NMXTYWWEDGNCRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=C(C(=CC=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)