CAS 1406392-75-3 appears in our catalog under these names: 2-({((1R)-1-phenylethyl)amino}methyl)-3,4-dihydroquinazolin-4-one, 95%, 2-({((1R)-1-Phenylethyl)amino}methyl)-3,4-dihydroquinazolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[[[(1R)-1-phenylethyl]amino]methyl]-3H-quinazolin-4-one (CAS 1406392-75-3) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: 2-[[[(1R)-1-phenylethyl]amino]methyl]-3H-quinazolin-4-one. InChIKey: RPQDFWLDFGGRKB-GFCCVEGCSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 2-[[[(1R)-1-phenylethyl]amino]methyl]-3H-quinazolin-4-one |
| InChIKey | RPQDFWLDFGGRKB-GFCCVEGCSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCC2=NC3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)