Products 1406484-89-6

CAS 1406484-89-6 is the registry number for 4-((2-Bromophenyl)thio)-3-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-bromophenyl)sulfanyl-3-methylbenzoic acid (CAS 1406484-89-6) is a chemical compound with the molecular formula C14H11BrO2S and a molecular weight of 323.21 g/mol. IUPAC name: 4-(2-bromophenyl)sulfanyl-3-methylbenzoic acid. InChIKey: ZYATVDGAILKUDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BrO2S
Molecular weight323.21 g/mol
IUPAC name4-(2-bromophenyl)sulfanyl-3-methylbenzoic acid
InChIKeyZYATVDGAILKUDQ-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(=O)O)SC2=CC=CC=C2Br

Computed by PubChem (NCBI)