Products 98808-50-5
CAS 98808-50-5 appears in our catalog under these names: 2-[(4-Bromobenzyl)thio]benzoic acid, 95%, 2-{((4-Bromophenyl)methyl)sulfanyl}benzoic acid, 2-((4-Bromobenzyl)thio)benzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[(4-bromophenyl)methylsulfanyl]benzoic acid (CAS 98808-50-5) is a chemical compound with the molecular formula C14H11BrO2S and a molecular weight of 323.21 g/mol. IUPAC name: 2-[(4-bromophenyl)methylsulfanyl]benzoic acid. InChIKey: ITEYFCUZWSWOKH-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2S |
|---|---|
| Molecular weight | 323.21 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methylsulfanyl]benzoic acid |
| InChIKey | ITEYFCUZWSWOKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)SCC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
2-{[(4-bromophenyl)methyl]sulfanyl}benzoic acid, 2-[(4-bromobenzyl)thio]benzoic acid, 2-((4-Bromobenzyl)thio)benzoic acid, 2-[(4-bromophenyl)methylsulfanyl]benzoic Acid, 2-[(4-bromophenyl)methylthio]benzoic acid, 2-[[(4-Bromophenyl)methyl]thio]benzoic acid, 2-{[(4-bromophenyl)methyl]sulfanyl}benzoicacid, Benzoic acid, 2-[[(4-bromophenyl)methyl]thio]-