CAS 43076-89-7 is the registry number for 9-Bromo-10-methoxy-9,10-dihydro-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-bromo-8-methoxy-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-one (CAS 43076-89-7) is a chemical compound with the molecular formula C14H11BrO2S and a molecular weight of 323.21 g/mol. IUPAC name: 9-bromo-8-methoxy-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-one. InChIKey: XGKDFPWTQAWELY-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2S |
|---|---|
| Molecular weight | 323.21 g/mol |
| IUPAC name | 9-bromo-8-methoxy-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-one |
| InChIKey | XGKDFPWTQAWELY-UHFFFAOYSA-N |
| SMILES | COC1C(C2=CC=CC=C2C(=O)C3=C1SC=C3)Br |
Computed by PubChem (NCBI)