CAS 14065-45-3 appears in our catalog under these names: Methyl 4-chloro-2-sulfamoylbenzoate, 95%, Methyl 4-chloro-2-sulfamoylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 4-chloro-2-sulfamoylbenzoate (CAS 14065-45-3) is a chemical compound with the molecular formula C8H8ClNO4S and a molecular weight of 249.67 g/mol. IUPAC name: methyl 4-chloro-2-sulfamoylbenzoate. InChIKey: YLXAMHXQOPJCRX-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4S |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | methyl 4-chloro-2-sulfamoylbenzoate |
| InChIKey | YLXAMHXQOPJCRX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)