Products 1406861-12-8

CAS 1406861-12-8 is the registry number for 6-[2-(1,1-Dimethylethyl)-4-methoxyphenoxy]hexanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

6-(2-tert-butyl-4-methoxyphenoxy)hexanoic acid (CAS 1406861-12-8) is a chemical compound with the molecular formula C17H26O4 and a molecular weight of 294.4 g/mol. IUPAC name: 6-(2-tert-butyl-4-methoxyphenoxy)hexanoic acid. InChIKey: UCHAFQUOKHQWFO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26O4
Molecular weight294.4 g/mol
IUPAC name6-(2-tert-butyl-4-methoxyphenoxy)hexanoic acid
InChIKeyUCHAFQUOKHQWFO-UHFFFAOYSA-N
SMILESCC(C)(C)C1=C(C=CC(=C1)OC)OCCCCCC(=O)O

Computed by PubChem (NCBI)