CAS 61065-63-2 is the registry number for 2-(3-Acetoxyadamantan-1-yl)propan-2-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(2-acetyloxypropan-2-yl)-1-adamantyl] acetate (CAS 61065-63-2) is a chemical compound with the molecular formula C17H26O4 and a molecular weight of 294.4 g/mol. IUPAC name: [3-(2-acetyloxypropan-2-yl)-1-adamantyl] acetate. InChIKey: RLXDPLARQIAXJE-UHFFFAOYSA-N.
| Molecular formula | C17H26O4 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | [3-(2-acetyloxypropan-2-yl)-1-adamantyl] acetate |
| InChIKey | RLXDPLARQIAXJE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC12CC3CC(C1)CC(C3)(C2)C(C)(C)OC(=O)C |
Computed by PubChem (NCBI)