CAS 20482-21-7 is the registry number for 8-o-Acetyltorilolone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
[(5S,6R,8S,8aR)-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] acetate (CAS 20482-21-7) is a chemical compound with the molecular formula C17H26O4 and a molecular weight of 294.4 g/mol. IUPAC name: [(5S,6R,8S,8aR)-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] acetate. InChIKey: WGWWLRBCCJXTGQ-UODBANLJSA-N.
| Molecular formula | C17H26O4 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | [(5S,6R,8S,8aR)-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] acetate |
| InChIKey | WGWWLRBCCJXTGQ-UODBANLJSA-N |
| SMILES | C[C@H]1C[C@H]([C@H](CC2=C(C(=O)C[C@H]12)C)C(C)(C)O)OC(=O)C |
Computed by PubChem (NCBI)