Products 2913573-39-2
CAS 2913573-39-2 is the registry number for 1-Bromo-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene (CAS 2913573-39-2) is a chemical compound with the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. IUPAC name: 1-bromo-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene. InChIKey: GFNDRIQLIMAPRF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6 |
|---|---|
| Molecular weight | 307.03 g/mol |
| IUPAC name | 1-bromo-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene |
| InChIKey | GFNDRIQLIMAPRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CC(F)(F)F)Br |
Computed by PubChem (NCBI)