Products 1406908-37-9

CAS 1406908-37-9 appears in our catalog under these names: 5,5-Dimethyl-6-oxaspiro(2.5)octane-1-carboxylic acid, 98%, 5,5-Dimethyl-6-oxaspiro(2.5)octane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.

5,5-dimethyl-6-oxaspiro[2.5]octane-2-carboxylic acid (CAS 1406908-37-9) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 5,5-dimethyl-6-oxaspiro[2.5]octane-2-carboxylic acid. InChIKey: UBXDJATULWHIRT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O3
Molecular weight184.23 g/mol
IUPAC name5,5-dimethyl-6-oxaspiro[2.5]octane-2-carboxylic acid
InChIKeyUBXDJATULWHIRT-UHFFFAOYSA-N
SMILESCC1(CC2(CCO1)CC2C(=O)O)C

Computed by PubChem (NCBI)