Products 1407523-31-2
CAS 1407523-31-2 appears in our catalog under these names: Fl–DIBO, Fl-DIBO, 99.60%, Fl-DIBO, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 50 mg, 5 mg, 10 mg, 100 mg, 25 mg, 1mg.
8,15-dimethoxytetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-11-yn-3-one (CAS 1407523-31-2) is a chemical compound with the molecular formula C19H12O3 and a molecular weight of 288.3 g/mol. IUPAC name: 8,15-dimethoxytetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-11-yn-3-one. InChIKey: BZYUEUWYGRHCPO-UHFFFAOYSA-N.
| Molecular formula | C19H12O3 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 8,15-dimethoxytetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-11-yn-3-one |
| InChIKey | BZYUEUWYGRHCPO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(C3=O)C4=C(C=C(C=C4)OC)C#C2 |
Computed by PubChem (NCBI)