CAS 22812-50-6 appears in our catalog under these names: A-Naphthoflavonol, 95%, alpha-Naphthoflavanol, 3-Hydroxy-2-phenyl-4H-benzo[h]chromen-4-one 97%, alpha-Naphthoflavanol, 97%, 97%, alpha-Naphthoflavanol, min. 95 %, 500 mg. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Roth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 100mg, 2g.
3-hydroxy-2-phenylbenzo[h]chromen-4-one (CAS 22812-50-6) is a chemical compound with the molecular formula C19H12O3 and a molecular weight of 288.3 g/mol. IUPAC name: 3-hydroxy-2-phenylbenzo[h]chromen-4-one. InChIKey: NXKPKOFDBHWAGX-UHFFFAOYSA-N.
| Molecular formula | C19H12O3 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 3-hydroxy-2-phenylbenzo[h]chromen-4-one |
| InChIKey | NXKPKOFDBHWAGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C4=CC=CC=C4C=C3)O |
Computed by PubChem (NCBI)