CAS 2170020-69-4 is the registry number for 2-hydroxy-5-(4-hydroxyphenyl)-1H-phenalen-1-one. Offered by: TRC. Available pack sizes: 250mg.
2-hydroxy-5-(4-hydroxyphenyl)phenalen-1-one (CAS 2170020-69-4) is a chemical compound with the molecular formula C19H12O3 and a molecular weight of 288.3 g/mol. IUPAC name: 2-hydroxy-5-(4-hydroxyphenyl)phenalen-1-one. InChIKey: OWLCEBLKTSXXFA-UHFFFAOYSA-N.
| Molecular formula | C19H12O3 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-hydroxy-5-(4-hydroxyphenyl)phenalen-1-one |
| InChIKey | OWLCEBLKTSXXFA-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)C(=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)