CAS 1408057-38-4 is the registry number for (1R,5S)-3-Boc-6-oxa-3-azabicyclo-[3.2.1]octane-8-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl (1R,5R)-8-oxo-6-oxa-3-azabicyclo[3.2.1]octane-3-carboxylate (CAS 1408057-38-4) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: tert-butyl (1R,5R)-8-oxo-6-oxa-3-azabicyclo[3.2.1]octane-3-carboxylate. InChIKey: OJMIJZAIJKFKJV-HTQZYQBOSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | tert-butyl (1R,5R)-8-oxo-6-oxa-3-azabicyclo[3.2.1]octane-3-carboxylate |
| InChIKey | OJMIJZAIJKFKJV-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CO[C@H](C1)C2=O |
Computed by PubChem (NCBI)