Products 1408390-63-5
CAS 1408390-63-5 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)-1h-indole-2-carboxylic acid, 95%, 1-(2,2,2-Trifluoroethyl)-1H-indole-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
1-(2,2,2-trifluoroethyl)indole-2-carboxylic acid (CAS 1408390-63-5) is a chemical compound with the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)indole-2-carboxylic acid. InChIKey: SGHDYKFOYDYTJJ-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO2 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)indole-2-carboxylic acid |
| InChIKey | SGHDYKFOYDYTJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)