CAS 415918-12-6 appears in our catalog under these names: Methyl 6–(trifluoromethyl)–1H–indole–3–carboxylate, Methyl 6-(trifluoromethyl)-1h-indole-3-carboxylate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Methyl 6-(trifluoromethyl)-1H-indole-3-carboxylate (CAS 415918-12-6) is a chemical compound with the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. IUPAC name: methyl 6-(trifluoromethyl)-1H-indole-3-carboxylate. InChIKey: NLOZHNZNDVZPBE-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO2 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | methyl 6-(trifluoromethyl)-1H-indole-3-carboxylate |
| InChIKey | NLOZHNZNDVZPBE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C1C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)