CAS 378802-40-5 appears in our catalog under these names: 2-(5-Trifluoromethyl-1h-indol-3-yl)acetic acid, 95%, 2–(5–(Trifluoromethyl)–1H–indol–3–yl)acetic acid, 2-(5-(Trifluoromethyl)-1H-indol-3-yl)acetic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 250mg.
2-[5-(trifluoromethyl)-1H-indol-3-yl]acetic acid (CAS 378802-40-5) is a chemical compound with the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. IUPAC name: 2-[5-(trifluoromethyl)-1H-indol-3-yl]acetic acid. InChIKey: JSNULZACNINBHS-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO2 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | 2-[5-(trifluoromethyl)-1H-indol-3-yl]acetic acid |
| InChIKey | JSNULZACNINBHS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=CN2)CC(=O)O |
Computed by PubChem (NCBI)