CAS 14091-08-8 appears in our catalog under these names: 4-Chloro-D-phenylalanine, 98%, 4-Chloro-D-phenylalanine, 97%, 4-Chloro-D-Phenylalanine, D-4-Chlorophenylalanine, 4–Chloro–D–Phe–OH·HCl. Offered by: Combi-blocks, Creative Peptides, Chemat Brand, GLPBio, Iris Biotech. Available pack sizes: 1g, 10g, 5g, 25g, on request, 100g, 250mg, 100 g.
(2R)-2-amino-3-(4-chlorophenyl)propanoic acid (CAS 14091-08-8) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (2R)-2-amino-3-(4-chlorophenyl)propanoic acid. InChIKey: NIGWMJHCCYYCSF-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-chlorophenyl)propanoic acid |
| InChIKey | NIGWMJHCCYYCSF-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)