CAS 140911-30-4 is the registry number for 3-(Trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyrazin-8(7H)-one. Offered by: Biosynth. Available pack sizes: 5g.
3-(trifluoromethyl)-7H-[1,2,4]triazolo[4,3-a]pyrazin-8-one (CAS 140911-30-4) is a chemical compound with the molecular formula C6H3F3N4O and a molecular weight of 204.11 g/mol. IUPAC name: 3-(trifluoromethyl)-7H-[1,2,4]triazolo[4,3-a]pyrazin-8-one. InChIKey: AKSBEPXPVPRRHX-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N4O |
|---|---|
| Molecular weight | 204.11 g/mol |
| IUPAC name | 3-(trifluoromethyl)-7H-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| InChIKey | AKSBEPXPVPRRHX-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NN=C2C(F)(F)F)C(=O)N1 |
Computed by PubChem (NCBI)