CAS 299918-83-5 is the registry number for 5-(Trifluoromethyl)-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 299918-83-5) is a chemical compound with the molecular formula C6H3F3N4O and a molecular weight of 204.11 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: QHTMBKSOMNTQJU-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N4O |
|---|---|
| Molecular weight | 204.11 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | QHTMBKSOMNTQJU-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2N=CNN2C1=O)C(F)(F)F |
Computed by PubChem (NCBI)