CAS 2268-13-5 appears in our catalog under these names: 8-(Trifluoromethyl)-9H-purin-6-ol, 97%, 8-(Trifluoromethyl)-6,7-dihydro-1H-purin-6-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-(trifluoromethyl)-1,7-dihydropurin-6-one (CAS 2268-13-5) is a chemical compound with the molecular formula C6H3F3N4O and a molecular weight of 204.11 g/mol. IUPAC name: 8-(trifluoromethyl)-1,7-dihydropurin-6-one. InChIKey: AIDIFVVKEBYXLE-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N4O |
|---|---|
| Molecular weight | 204.11 g/mol |
| IUPAC name | 8-(trifluoromethyl)-1,7-dihydropurin-6-one |
| InChIKey | AIDIFVVKEBYXLE-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)N1)NC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)