CAS 14105-88-5 appears in our catalog under these names: 3-Aminochroman-4-one hydrochloride, 95+%, 3-Amino-3,4-dihydro-2H-1-benzopyran-4-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-amino-2,3-dihydrochromen-4-one;hydrochloride (CAS 14105-88-5) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 3-amino-2,3-dihydrochromen-4-one;hydrochloride. InChIKey: YUWWVDYPEZGAEW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 3-amino-2,3-dihydrochromen-4-one;hydrochloride |
| InChIKey | YUWWVDYPEZGAEW-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=CC=CC=C2O1)N.Cl |
Computed by PubChem (NCBI)