Products 1410854-19-1
CAS 1410854-19-1 is the registry number for (S)-2-Amino-3-(pyren-1-yl)propanoic acid hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-3-pyren-1-ylpropanoic acid;hydrochloride (CAS 1410854-19-1) is a chemical compound with the molecular formula C19H16ClNO2 and a molecular weight of 325.8 g/mol. IUPAC name: (2S)-2-amino-3-pyren-1-ylpropanoic acid;hydrochloride. InChIKey: XFLRFOCYZVMQDJ-NTISSMGPSA-N.
| Molecular formula | C19H16ClNO2 |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | (2S)-2-amino-3-pyren-1-ylpropanoic acid;hydrochloride |
| InChIKey | XFLRFOCYZVMQDJ-NTISSMGPSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)