CAS 141120-17-4 appears in our catalog under these names: (2-Amino-2,3-dihydro-1H-inden-2-yl)phosphonic acid hydrochloride, 97%, (2-Amino-2,3-dihydro-1H-inden-2-yl)-phosphonic Acid, 2-aminoindan-2-phosphonic acid, 95+%, Phosphonic acid, (2-amino-2,3-dihydro-1H-inden-2-yl)-, 2-aminoindan-2-phosphonic acid, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 1000mg, 5000mg, 10 mg.
(2-amino-1,3-dihydroinden-2-yl)phosphonic acid (CAS 141120-17-4) is a chemical compound with the molecular formula C9H12NO3P and a molecular weight of 213.17 g/mol. IUPAC name: (2-amino-1,3-dihydroinden-2-yl)phosphonic acid. InChIKey: YJFRDRWPYDVEIH-UHFFFAOYSA-N.
| Molecular formula | C9H12NO3P |
|---|---|
| Molecular weight | 213.17 g/mol |
| IUPAC name | (2-amino-1,3-dihydroinden-2-yl)phosphonic acid |
| InChIKey | YJFRDRWPYDVEIH-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC1(N)P(=O)(O)O |
Computed by PubChem (NCBI)