CAS 2613383-80-3 appears in our catalog under these names: Methyl 5-(dimethylphosphoryl)nicotinate 97%, Methyl 5-(dimethylphosphoryl)nicotinate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Methyl 5-dimethylphosphorylpyridine-3-carboxylate (CAS 2613383-80-3) is a chemical compound with the molecular formula C9H12NO3P and a molecular weight of 213.17 g/mol. IUPAC name: methyl 5-dimethylphosphorylpyridine-3-carboxylate. InChIKey: RAUTWYDRPAZGIJ-UHFFFAOYSA-N.
| Molecular formula | C9H12NO3P |
|---|---|
| Molecular weight | 213.17 g/mol |
| IUPAC name | methyl 5-dimethylphosphorylpyridine-3-carboxylate |
| InChIKey | RAUTWYDRPAZGIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN=C1)P(=O)(C)C |
Computed by PubChem (NCBI)