CAS 2639436-57-8 is the registry number for Methyl 4-(dimethylphosphoryl)picolinate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-dimethylphosphorylpyridine-2-carboxylate (CAS 2639436-57-8) is a chemical compound with the molecular formula C9H12NO3P and a molecular weight of 213.17 g/mol. IUPAC name: methyl 4-dimethylphosphorylpyridine-2-carboxylate. InChIKey: IKZJNZHGPUVADY-UHFFFAOYSA-N.
| Molecular formula | C9H12NO3P |
|---|---|
| Molecular weight | 213.17 g/mol |
| IUPAC name | methyl 4-dimethylphosphorylpyridine-2-carboxylate |
| InChIKey | IKZJNZHGPUVADY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC(=C1)P(=O)(C)C |
Computed by PubChem (NCBI)