Products 1411715-12-2
CAS 1411715-12-2 is the registry number for (2-Bromo-4,5-difluorophenyl)trimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-bromo-4,5-difluorophenyl)-trimethylsilane (CAS 1411715-12-2) is a chemical compound with the molecular formula C9H11BrF2Si and a molecular weight of 265.17 g/mol. IUPAC name: (2-bromo-4,5-difluorophenyl)-trimethylsilane. InChIKey: CSITVAZXFKMLMF-UHFFFAOYSA-N.
| Molecular formula | C9H11BrF2Si |
|---|---|
| Molecular weight | 265.17 g/mol |
| IUPAC name | (2-bromo-4,5-difluorophenyl)-trimethylsilane |
| InChIKey | CSITVAZXFKMLMF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=C(C(=C1)F)F)Br |
Computed by PubChem (NCBI)