CAS 473417-24-2 appears in our catalog under these names: (6-Bromo-2,3-difluorophenyl)trimethylsilane, 95%, (6-Bromo-2,3-difluorophenyl)trimethylsilane. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
(6-bromo-2,3-difluorophenyl)-trimethylsilane (CAS 473417-24-2) is a chemical compound with the molecular formula C9H11BrF2Si and a molecular weight of 265.17 g/mol. IUPAC name: (6-bromo-2,3-difluorophenyl)-trimethylsilane. InChIKey: CZSSGHFPSCELKI-UHFFFAOYSA-N.
| Molecular formula | C9H11BrF2Si |
|---|---|
| Molecular weight | 265.17 g/mol |
| IUPAC name | (6-bromo-2,3-difluorophenyl)-trimethylsilane |
| InChIKey | CZSSGHFPSCELKI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC(=C1F)F)Br |
Computed by PubChem (NCBI)