CAS 1417332-30-9 is the registry number for (4-Bromo-2,5-difluorophenyl)trimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromo-2,5-difluorophenyl)-trimethylsilane (CAS 1417332-30-9) is a chemical compound with the molecular formula C9H11BrF2Si and a molecular weight of 265.17 g/mol. IUPAC name: (4-bromo-2,5-difluorophenyl)-trimethylsilane. InChIKey: VIYXTVOBDVJBIE-UHFFFAOYSA-N.
| Molecular formula | C9H11BrF2Si |
|---|---|
| Molecular weight | 265.17 g/mol |
| IUPAC name | (4-bromo-2,5-difluorophenyl)-trimethylsilane |
| InChIKey | VIYXTVOBDVJBIE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=C(C(=C1)F)Br)F |
Computed by PubChem (NCBI)