Products 141172-08-9
CAS 141172-08-9 is the registry number for SS28. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,2,3-trimethoxy-5-[(Z)-2-(4-methylphenyl)ethenyl]benzene (CAS 141172-08-9) is a chemical compound with the molecular formula C18H20O3 and a molecular weight of 284.3 g/mol. IUPAC name: 1,2,3-trimethoxy-5-[(Z)-2-(4-methylphenyl)ethenyl]benzene. InChIKey: YSJFPRSDNPCGBF-KTKRTIGZSA-N.
| Molecular formula | C18H20O3 |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 1,2,3-trimethoxy-5-[(Z)-2-(4-methylphenyl)ethenyl]benzene |
| InChIKey | YSJFPRSDNPCGBF-KTKRTIGZSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)