Products 1412448-29-3
CAS 1412448-29-3 appears in our catalog under these names: N-(3,5-Dichloropyridin-4-yl)-3,4-dihydroxybenzamide, 95%, 95%, Roflumilast impurity 2, Roflumilast impurity 2, 95%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, Get quote, 50mg.
N-(3,5-dichloro-4-pyridinyl)-3,4-dihydroxybenzamide (CAS 1412448-29-3) is a chemical compound with the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. IUPAC name: N-(3,5-dichloro-4-pyridinyl)-3,4-dihydroxybenzamide. InChIKey: YSANJZAAUIRCNK-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O3 |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | N-(3,5-dichloro-4-pyridinyl)-3,4-dihydroxybenzamide |
| InChIKey | YSANJZAAUIRCNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NC2=C(C=NC=C2Cl)Cl)O)O |
Computed by PubChem (NCBI)