CAS 1820647-18-4 is the registry number for 3-(3,5-Dichloro-2-oxo-2h-pyrazin-1-yl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-(3,5-dichloro-2-oxopyrazin-1-yl)benzoate (CAS 1820647-18-4) is a chemical compound with the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. IUPAC name: methyl 3-(3,5-dichloro-2-oxopyrazin-1-yl)benzoate. InChIKey: CNXOMHADUKFVQW-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O3 |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | methyl 3-(3,5-dichloro-2-oxopyrazin-1-yl)benzoate |
| InChIKey | CNXOMHADUKFVQW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)N2C=C(N=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)