Products 1820647-18-4

CAS 1820647-18-4 is the registry number for 3-(3,5-Dichloro-2-oxo-2h-pyrazin-1-yl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(3,5-dichloro-2-oxopyrazin-1-yl)benzoate (CAS 1820647-18-4) is a chemical compound with the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. IUPAC name: methyl 3-(3,5-dichloro-2-oxopyrazin-1-yl)benzoate. InChIKey: CNXOMHADUKFVQW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl2N2O3
Molecular weight299.11 g/mol
IUPAC namemethyl 3-(3,5-dichloro-2-oxopyrazin-1-yl)benzoate
InChIKeyCNXOMHADUKFVQW-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC=C1)N2C=C(N=C(C2=O)Cl)Cl

Computed by PubChem (NCBI)