Products 208122-62-7
CAS 208122-62-7 is the registry number for 3-(2,4-Dichlorophenoxy)-5-nitroaniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(2,4-dichlorophenoxy)-5-nitroaniline (CAS 208122-62-7) is a chemical compound with the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. IUPAC name: 3-(2,4-dichlorophenoxy)-5-nitroaniline. InChIKey: OHVHXQWQOYYKMQ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O3 |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 3-(2,4-dichlorophenoxy)-5-nitroaniline |
| InChIKey | OHVHXQWQOYYKMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OC2=CC(=CC(=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)