CAS 141281-38-1 appears in our catalog under these names: 3-Methyl-4-nitrobenzyl bromide, 98%, 3-Methyl-4-nitrobenzyl bromide 98%, 3-Methyl-4-nitrobenzyl bromide, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 100g, 5g, 250mg, 1g.
4-(bromomethyl)-2-methyl-1-nitrobenzene (CAS 141281-38-1) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 4-(bromomethyl)-2-methyl-1-nitrobenzene. InChIKey: WOUWGCLQOJPWHS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 4-(bromomethyl)-2-methyl-1-nitrobenzene |
| InChIKey | WOUWGCLQOJPWHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)