CAS 14132-84-4 appears in our catalog under these names: 5-Anilino-4-phenyl-4h-1,2,4-triazole-3-thiol, 95%, 4-Phenyl-3-(phenylamino)-1H-1,2,4-triazole-5(4H)-thione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-anilino-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 14132-84-4) is a chemical compound with the molecular formula C14H12N4S and a molecular weight of 268.34 g/mol. IUPAC name: 3-anilino-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: ADVANMXLTWBUFC-UHFFFAOYSA-N.
| Molecular formula | C14H12N4S |
|---|---|
| Molecular weight | 268.34 g/mol |
| IUPAC name | 3-anilino-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | ADVANMXLTWBUFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NNC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)