CAS 315702-89-7 appears in our catalog under these names: N-(4-Pyridin-2-yl-thiazol-2-yl)benzene-1,4-diamine, 95+%, N-(4-Pyridin-2-yl-thiazol-2-yl)benzene-1,4-diamine. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
4-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine (CAS 315702-89-7) is a chemical compound with the molecular formula C14H12N4S and a molecular weight of 268.34 g/mol. IUPAC name: 4-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine. InChIKey: HURGMNZUGRQOHU-UHFFFAOYSA-N.
| Molecular formula | C14H12N4S |
|---|---|
| Molecular weight | 268.34 g/mol |
| IUPAC name | 4-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine |
| InChIKey | HURGMNZUGRQOHU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)NC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)