CAS 74270-78-3 appears in our catalog under these names: 4-Benzyl-5-pyridin-4-yl-4h-[1,2,4]triazole-3-thiol, 95%, 4-Benzyl-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol, 4-Benzyl-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol, 97%, 97%, 4-benzyl-3-(pyridin-4-yl)-4,5-dihydro-1H-1,2,4-triazole-5-thione. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 0,5g, 500mg.
4-benzyl-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (CAS 74270-78-3) is a chemical compound with the molecular formula C14H12N4S and a molecular weight of 268.34 g/mol. IUPAC name: 4-benzyl-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione. InChIKey: CPPAKJNMGGTEHY-UHFFFAOYSA-N.
| Molecular formula | C14H12N4S |
|---|---|
| Molecular weight | 268.34 g/mol |
| IUPAC name | 4-benzyl-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | CPPAKJNMGGTEHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NNC2=S)C3=CC=NC=C3 |
Computed by PubChem (NCBI)