CAS 1414029-51-8 appears in our catalog under these names: N,N-Dimethyl 4-bromo-3-nitrobenzylamine, 98%, N,N–Dimethyl 4–bromo–3–nitrobenzylamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
1-(4-bromo-3-nitrophenyl)-N,N-dimethylmethanamine (CAS 1414029-51-8) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 1-(4-bromo-3-nitrophenyl)-N,N-dimethylmethanamine. InChIKey: ZIYYEEOESKIGRR-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 1-(4-bromo-3-nitrophenyl)-N,N-dimethylmethanamine |
| InChIKey | ZIYYEEOESKIGRR-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)