CAS 14149-32-7 appears in our catalog under these names: 4-Methyl-4-phenylpiperidine-2,6-dione, 95%, 4-Methyl-4-phenylpiperidine-2,6-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-methyl-4-phenylpiperidine-2,6-dione (CAS 14149-32-7) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 4-methyl-4-phenylpiperidine-2,6-dione. InChIKey: JBCWFKPZSNLYQO-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-methyl-4-phenylpiperidine-2,6-dione |
| InChIKey | JBCWFKPZSNLYQO-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)