CAS 1415250-77-9 appears in our catalog under these names: 4,6-Dimethyl-[1,1'-biphenyl]-2,5-dione, 95%, 95%, 4,6-Dimethyl-[1,1'-biphenyl]-2,5-dione, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3,5-dimethyl-2-phenylcyclohexa-2,5-diene-1,4-dione (CAS 1415250-77-9) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 3,5-dimethyl-2-phenylcyclohexa-2,5-diene-1,4-dione. InChIKey: YNXAUKOKTHKROU-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3,5-dimethyl-2-phenylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | YNXAUKOKTHKROU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(C1=O)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)