CAS 1415257-78-1 appears in our catalog under these names: (S)-1-(3-Fluoro-4-(trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, (S)–1–(3–Fluoro–4–(trifluoromethyl)phenyl)ethanamine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(1S)-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 1415257-78-1) is a chemical compound with the molecular formula C9H10ClF4N and a molecular weight of 243.63 g/mol. IUPAC name: (1S)-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: NLBPCMJOACOYKH-JEDNCBNOSA-N.
| Molecular formula | C9H10ClF4N |
|---|---|
| Molecular weight | 243.63 g/mol |
| IUPAC name | (1S)-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | NLBPCMJOACOYKH-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)C(F)(F)F)F)N.Cl |
Computed by PubChem (NCBI)