CAS 875305-28-5 is the registry number for 2-[3-Fluoro-4-(trifluoromethyl)phenyl]ethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 875305-28-5) is a chemical compound with the molecular formula C9H10ClF4N and a molecular weight of 243.63 g/mol. IUPAC name: 2-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: HXWGSKOVMVHKEK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF4N |
|---|---|
| Molecular weight | 243.63 g/mol |
| IUPAC name | 2-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | HXWGSKOVMVHKEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCN)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)