CAS 2193067-83-1 is the registry number for (4-(1,2,2,2-Tetrafluoroethyl)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[4-(1,2,2,2-tetrafluoroethyl)phenyl]methanamine;hydrochloride (CAS 2193067-83-1) is a chemical compound with the molecular formula C9H10ClF4N and a molecular weight of 243.63 g/mol. IUPAC name: [4-(1,2,2,2-tetrafluoroethyl)phenyl]methanamine;hydrochloride. InChIKey: QBGMKLFEAGBKFM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF4N |
|---|---|
| Molecular weight | 243.63 g/mol |
| IUPAC name | [4-(1,2,2,2-tetrafluoroethyl)phenyl]methanamine;hydrochloride |
| InChIKey | QBGMKLFEAGBKFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(C(F)(F)F)F.Cl |
Computed by PubChem (NCBI)