CAS 3955-72-4 is the registry number for 3-Methylphenyl tosylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
(3-methylphenyl) 4-methylbenzenesulfonate (CAS 3955-72-4) is a chemical compound with the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. IUPAC name: (3-methylphenyl) 4-methylbenzenesulfonate. InChIKey: VIKTUZZYGHKELS-UHFFFAOYSA-N.
| Molecular formula | C14H14O3S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | (3-methylphenyl) 4-methylbenzenesulfonate |
| InChIKey | VIKTUZZYGHKELS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)