CAS 1415824-99-5 is the registry number for 4-Phenoxy-2-(trifluoromethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[4-phenoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 1415824-99-5) is a chemical compound with the molecular formula C13H10BF3O3 and a molecular weight of 282.02 g/mol. IUPAC name: [4-phenoxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: DPZHTCBBYPEVJV-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O3 |
|---|---|
| Molecular weight | 282.02 g/mol |
| IUPAC name | [4-phenoxy-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | DPZHTCBBYPEVJV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC2=CC=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)