Products 1415824-99-5

CAS 1415824-99-5 is the registry number for 4-Phenoxy-2-(trifluoromethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[4-phenoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 1415824-99-5) is a chemical compound with the molecular formula C13H10BF3O3 and a molecular weight of 282.02 g/mol. IUPAC name: [4-phenoxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: DPZHTCBBYPEVJV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10BF3O3
Molecular weight282.02 g/mol
IUPAC name[4-phenoxy-2-(trifluoromethyl)phenyl]boronic acid
InChIKeyDPZHTCBBYPEVJV-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)OC2=CC=CC=C2)C(F)(F)F)(O)O

Computed by PubChem (NCBI)