CAS 1415839-18-7 appears in our catalog under these names: (R)–2–Isopropyl–2,3–dihydrobenzo(d)imidazo(2,1–b)thiazole, (R)-2-Isopropyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole, 97%, 97%, (R)-2-Isopropyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-propan-2-yl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole (CAS 1415839-18-7) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: (2R)-2-propan-2-yl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole. InChIKey: NRFXELMCDBIMBQ-VIFPVBQESA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | (2R)-2-propan-2-yl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole |
| InChIKey | NRFXELMCDBIMBQ-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H]1CN2C3=CC=CC=C3SC2=N1 |
Computed by PubChem (NCBI)