CAS 1415994-57-8 is the registry number for 5-Bromo-2-(1H-1,2,3,4-tetrazol-5-yl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-bromo-2-(2H-tetrazol-5-yl)aniline (CAS 1415994-57-8) is a chemical compound with the molecular formula C7H6BrN5 and a molecular weight of 240.06 g/mol. IUPAC name: 5-bromo-2-(2H-tetrazol-5-yl)aniline. InChIKey: ITEIQHWWPPEPEQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN5 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 5-bromo-2-(2H-tetrazol-5-yl)aniline |
| InChIKey | ITEIQHWWPPEPEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)N)C2=NNN=N2 |
Computed by PubChem (NCBI)