CAS 141607-28-5 appears in our catalog under these names: (2S,3R,4R,5S)–5–hydroxy–1–oxohexane–2,3,4–triyl triacetate, 2,3,4-Tri-O-acetyl-L-fucose. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 2g.
[(2S,3R,4R,5S)-4,5-diacetyloxy-6-hydroxy-2-methyloxan-3-yl] acetate (CAS 141607-28-5) is a chemical compound with the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. IUPAC name: [(2S,3R,4R,5S)-4,5-diacetyloxy-6-hydroxy-2-methyloxan-3-yl] acetate. InChIKey: QHOCNNVTMIFDFP-PFFKSSDRSA-N.
| Molecular formula | C12H18O8 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | [(2S,3R,4R,5S)-4,5-diacetyloxy-6-hydroxy-2-methyloxan-3-yl] acetate |
| InChIKey | QHOCNNVTMIFDFP-PFFKSSDRSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H](C(O1)O)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)