Products 14162-17-5
CAS 14162-17-5 appears in our catalog under these names: 1-(3-Chlorophenyl)tetrahydropyrimidin-2(1H)-one, 95%, 1-(3-Chlorophenyl)tetrahydropyrimidin-2(1H)-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(3-chlorophenyl)-1,3-diazinan-2-one (CAS 14162-17-5) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 1-(3-chlorophenyl)-1,3-diazinan-2-one. InChIKey: WZLYGKQITJBJMP-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-1,3-diazinan-2-one |
| InChIKey | WZLYGKQITJBJMP-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)